JEE Challenger
More from Trigonometric Functions

Value of Sine Expression Involving Roots of Quadratic Equation

Let tanA,tanB\tan A, \tan B, where A,B(π2,π2)A, B \in \left(-\frac{\pi}{2}, \frac{\pi}{2}\right), be the roots of the quadratic equation x22x5=0x^2 - 2x - 5 = 0. Then 20sin2(A+B2)20 \sin^2 \left(\frac{A + B}{2}\right) is equal to:

Options

A

10+1010 + \sqrt{10}

B

1021010 - 2\sqrt{10}

C

1031010 - 3\sqrt{10}

Correct
D

101010 - \sqrt{10}

Step-by-Step Solution

Given that tanA\tan A and tanB\tan B are the roots of the quadratic equation x22x5=0x^2 - 2x - 5 = 0, where A,B(π2,π2)A, B \in \left(-\frac{\pi}{2}, \frac{\pi}{2}\right), we can use Vieta's formulas to write: tanA+tanB=2\tan A + \tan B = 2 tanAtanB=5\tan A \cdot \tan B = -5

Using the compound angle formula for tangent: tan(A+B)=tanA+tanB1tanAtanB=21(5)=26=13\tan(A+B) = \frac{\tan A + \tan B}{1 - \tan A \tan B} = \frac{2}{1 - (-5)} = \frac{2}{6} = \frac{1}{3}

To determine the quadrant of A+BA+B, we solve for the roots of x22x5=0x^2 - 2x - 5 = 0: x=2±44(1)(5)2=1±6x = \frac{2 \pm \sqrt{4 - 4(1)(-5)}}{2} = 1 \pm \sqrt{6}

Without loss of generality, let tanA=1+6\tan A = 1 + \sqrt{6} and tanB=16\tan B = 1 - \sqrt{6}. Since tanA3.449>1\tan A \approx 3.449 > 1 and A(π2,π2)A \in \left(-\frac{\pi}{2}, \frac{\pi}{2}\right), we have A(π4,π2)A \in \left(\frac{\pi}{4}, \frac{\pi}{2}\right). Similarly, since tanB1.449<1\tan B \approx -1.449 < -1 and B(π2,π2)B \in \left(-\frac{\pi}{2}, \frac{\pi}{2}\right), we have B(π2,π4)B \in \left(-\frac{\pi}{2}, -\frac{\pi}{4}\right).

Notice that tanA=1+6>61=tanB=tan(B)\tan A = 1 + \sqrt{6} > \sqrt{6} - 1 = -\tan B = \tan(-B). Since A,B(0,π2)A, -B \in \left(0, \frac{\pi}{2}\right) and the tangent function is strictly increasing on this interval, A>B    A+B>0A > -B \implies A + B > 0. Also, adding the bounds of AA and BB: π4π2<A+B<π2π4    π4<A+B<π4\frac{\pi}{4} - \frac{\pi}{2} < A + B < \frac{\pi}{2} - \frac{\pi}{4} \implies -\frac{\pi}{4} < A + B < \frac{\pi}{4}

Since A+B>0A + B > 0 and A+B(π4,π4)A + B \in \left(-\frac{\pi}{4}, \frac{\pi}{4}\right), it follows that A+B(0,π4)A + B \in \left(0, \frac{\pi}{4}\right). Thus, cos(A+B)>0\cos(A+B) > 0.

Using the identity cos(A+B)=11+tan2(A+B)\cos(A+B) = \frac{1}{\sqrt{1 + \tan^2(A+B)}}: cos(A+B)=11+(13)2=1109=310\cos(A+B) = \frac{1}{\sqrt{1 + \left(\frac{1}{3}\right)^2}} = \frac{1}{\sqrt{\frac{10}{9}}} = \frac{3}{\sqrt{10}}

Now, using the half-angle formula 2sin2(θ2)=1cosθ2\sin^2\left(\frac{\theta}{2}\right) = 1 - \cos\theta: 20sin2(A+B2)=10[2sin2(A+B2)]=10(1cos(A+B))20 \sin^2 \left(\frac{A + B}{2}\right) = 10 \cdot \left[ 2 \sin^2 \left(\frac{A + B}{2}\right) \right] = 10 \left(1 - \cos(A+B)\right)

Substituting the value of cos(A+B)\cos(A+B): 20sin2(A+B2)=10(1310)=103010=1031020 \sin^2 \left(\frac{A + B}{2}\right) = 10 \left(1 - \frac{3}{\sqrt{10}}\right) = 10 - \frac{30}{\sqrt{10}} = 10 - 3\sqrt{10}

Hence, the correct option is C.

Value of Sine Expression Involving Roots of Quadratic Equation | Mathematics PYQ Solution - JEE Challenger