JEE Challenger
More from Biomolecules

Structure of D Aldotetrose Forming Optically Inactive Dicarboxylic Acid

A D-aldotetrose on oxidation with concentrated HNO3\text{HNO}_3 resulted in optically inactive dicarboxylic acid. The structure of the D-aldotetrose is:

Options

A
Option A
B
Option B
C
Option C
Correct
D
Option D

Topics & Concepts

BiomoleculesCarbohydrates

Step-by-Step Solution

To determine the correct structure of the D-aldotetrose, we analyze the configuration and the optical activity of the oxidation product step-by-step:

1. D-Configuration Criterion

In a Fischer projection, an aldotetrose is classified as a D-sugar if the hydroxyl group (OH-\text{OH}) on the highest-numbered chiral carbon (C-3\text{C-3}) is directed to the right.

  • Option A: C-3\text{C-3} has OH-\text{OH} on the left \rightarrow L-erythrose
  • Option B: C-3\text{C-3} has OH-\text{OH} on the left \rightarrow L-threose
  • Option C: C-3\text{C-3} has OH-\text{OH} on the right \rightarrow D-erythrose
  • Option D: C-3\text{C-3} has OH-\text{OH} on the right \rightarrow D-threose

Thus, only options C and D represent D-aldotetroses.


2. Oxidation Reaction with Concentrated HNO3\text{HNO}_3

Concentrated nitric acid (HNO3\text{HNO}_3) is a strong oxidizing agent. It oxidizes both the terminal aldehyde group (CHO-\text{CHO}) at C-1\text{C-1} and the primary alcohol group (CH2OH-\text{CH}_2\text{OH}) at C-4\text{C-4} into carboxylic acid (COOH-\text{COOH}) groups, forming an aldaric acid (tartaric acid derivative).

CHO-CH(OH)-CH(OH)-CH2OHconc. HNO3COOH-CH(OH)-CH(OH)-COOH\text{CHO-CH(OH)-CH(OH)-CH}_2\text{OH} \xrightarrow{\text{conc. HNO}_3} \text{COOH-CH(OH)-CH(OH)-COOH}


3. Optical Activity of the Oxidation Products

  • Oxidation of Option C (D-erythrose):

    COOHHCOHHCOHCOOH\begin{array}{c} \text{COOH} \\ | \\ \text{H}-\text{C}-\text{OH} \\ | \\ \text{H}-\text{C}-\text{OH} \\ | \\ \text{COOH} \end{array}

    The resulting dicarboxylic acid is meso-tartaric acid. This molecule possesses a horizontal plane of symmetry passing between C-2\text{C-2} and C-3\text{C-3}. Due to this internal symmetry, it is achiral and optically inactive.

  • Oxidation of Option D (D-threose):

    COOHHOCHHCOHCOOH\begin{array}{c} \text{COOH} \\ | \\ \text{HO}-\text{C}-\text{H} \\ | \\ \text{H}-\text{C}-\text{OH} \\ | \\ \text{COOH} \end{array}

    The resulting dicarboxylic acid lacks a plane of symmetry or center of inversion, making it chiral and optically active.


Conclusion

The D-aldotetrose that gives an optically inactive dicarboxylic acid upon oxidation with concentrated HNO3\text{HNO}_3 is D-erythrose, shown in Option C.

Correct Answer: C

Structure of D Aldotetrose Forming Optically Inactive Dicarboxylic Acid | Chemistry PYQ Solution - JEE Challenger