Mass of Organic Product Reacting to Liberate Gas at STP
Consider the following sequence of reactions to give the major product (X)
P g of the major product (X) formed is reacted with NaHCO3 solution to liberate a gas which occupied 11.2 dm3 at STP.
P= g.
(Given molar mass in g mol−1H:1, C:12, O:16, Cl:35.5)
To determine the mass P of the major product (X), we analyze the given sequence of reactions step-by-step:
Step 1: Reaction Sequence
Friedel-Crafts Alkylation:
Benzene reacts with methyl chloride (CH3Cl) in the presence of anhydrous AlCl3 to form toluene:
C6H6+CH3Clanhydrous AlCl3C6H5CH3+HCl
Electrophilic Aromatic Substitution (Chlorination):
The methyl group (−CH3) is an ortho/para-directing group. Due to steric hindrance at the ortho-position, the major product is p-chlorotoluene (4-chlorotoluene):
C6H5CH3+Cl2FeCl3Cl-C6H4-CH3(major product)
Oxidation of Side Chain:p-chlorotoluene is oxidized by K2Cr2O7/H2SO4, which selectively oxidizes the benzylic methyl group into a carboxylic acid group (−COOH):
Cl-C6H4-CH3K2Cr2O7/H2SO4Cl-C6H4-COOH(X)
Thus, the major product (X) is 4-chlorobenzoic acid (C7H5ClO2).
Step 2: Reaction with NaHCO3
4-chlorobenzoic acid reacts with sodium bicarbonate (NaHCO3) to liberate carbon dioxide (CO2) gas according to the equation:
Cl-C6H4-COOH+NaHCO3⟶Cl-C6H4-COONa+H2O+CO2↑
From the stoichiometry of the reaction:
1 mole of X produces 1 mole of CO2 gas.
Step 3: Molar Calculations
Volume of CO2 at STP:11.2 dm3=11.2 L
Moles of CO2 liberated:nCO2=22.4 L mol−111.2 L=0.5 mol
Therefore, moles of major product (X) reacted:
nX=0.5 mol
Molar mass of (X) (C7H5ClO2):Molar Mass=(7×12)+(5×1)+35.5+(2×16)=84+5+35.5+32=156.5 g mol−1
Mass P of major product (X):P=nX×Molar Mass=0.5 mol×156.5 g mol−1=78.25 g≈78 g
Answer:
78
Mass of Organic Product Reacting to Liberate Gas at STP | Chemistry PYQ Solution - JEE Challenger